About 4-ethyl-1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclohexan-1-ol
4-ethyl-1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclohexan-1-ol (PubChem CID 65118774) has the molecular formula C12H22F3NO2
and a molecular weight of 269.31 g/mol. Its IUPAC name is 4-ethyl-1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-ethyl-1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclohexan-1-ol |
| PubChem CID | 65118774 |
| Molecular Formula | C12H22F3NO2 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 4-ethyl-1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclohexan-1-ol |
| SMILES | CCC1CCC(O)(CNCC(O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H22F3NO2/c1-2-9-3-5-11(18,6-4-9)8-16-7-10(17)12(13,14)15/h9-10,16-18H,2-8H2,1H3 |
| InChIKey | QTCLKODSBQDNGG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclohexan-1-ol?
The IUPAC name of 4-ethyl-1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclohexan-1-ol (CID 65118774) is 4-ethyl-1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclohexan-1-ol.
What is the SMILES notation for 4-ethyl-1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclohexan-1-ol?
The canonical SMILES for 4-ethyl-1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclohexan-1-ol is CCC1CCC(O)(CNCC(O)C(F)(F)F)CC1.
What is the InChIKey of 4-ethyl-1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclohexan-1-ol?
The InChIKey is QTCLKODSBQDNGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F3NO2/c1-2-9-3-5-11(18,6-4-9)8-16-7-10(17)12(13,14)15/h9-10,16-18H,2-8H2,1H3.
What are the key properties of 4-ethyl-1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclohexan-1-ol?
4-ethyl-1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclohexan-1-ol has a molecular weight of 269.31 g/mol, XLogP of 1.83, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]cyclohexan-1-ol is sourced from PubChem (CID 65118774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).