C17H25NO2 — CID 65119076
N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-2-phenylacetamide (PubChem CID 65119076) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-2-phenylacetamide.
| Compound Name | N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 65119076 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-2-phenylacetamide |
| SMILES | CC1(C)CCC(O)(CNC(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C17H25NO2/c1-16(2)8-10-17(20,11-9-16)13-18-15(19)12-14-6-4-3-5-7-14/h3-7,20H,8-13H2,1-2H3,(H,18,19) |
| InChIKey | RYIVUGBQYJOKEM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |