C14H24F3NO3 — CID 65119268
N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 65119268) has the molecular formula C14H24F3NO3 and a molecular weight of 311.34 g/mol. Its IUPAC name is N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 65119268 |
| Molecular Formula | C14H24F3NO3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CC1(C)CCC(O)(CNC(=O)CCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H24F3NO3/c1-12(2)4-6-13(20,7-5-12)9-18-11(19)3-8-21-10-14(15,16)17/h20H,3-10H2,1-2H3,(H,18,19) |
| InChIKey | HMIBQACUTROSIT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|