About (3Z)-3-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one
(3Z)-3-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one (PubChem CID 6512038) has the molecular formula C22H14Cl2FNO2
and a molecular weight of 414.26 g/mol. Its IUPAC name is (3Z)-3-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one.
Molecular Properties
| Compound Name | (3Z)-3-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one |
| PubChem CID | 6512038 |
| Molecular Formula | C22H14Cl2FNO2 |
| Molecular Weight | 414.26 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | (3Z)-3-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2/C1=C/c1cc(Cl)c(OCc2ccccc2F)c(Cl)c1 |
| InChI | InChI=1S/C22H14Cl2FNO2/c23-17-10-13(9-16-15-6-2-4-8-20(15)26-22(16)27)11-18(24)21(17)28-12-14-5-1-3-7-19(14)25/h1-11H,12H2,(H,26,27)/b16-9- |
| InChIKey | IEPQENMABCSGCU-SXGWCWSVSA-N |
| XLogP | 6.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.26 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one?
The IUPAC name of (3Z)-3-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one (CID 6512038) is (3Z)-3-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one.
What is the SMILES notation for (3Z)-3-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one?
The canonical SMILES for (3Z)-3-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one is O=C1Nc2ccccc2/C1=C/c1cc(Cl)c(OCc2ccccc2F)c(Cl)c1.
What is the InChIKey of (3Z)-3-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one?
The InChIKey is IEPQENMABCSGCU-SXGWCWSVSA-N. The full InChI is InChI=1S/C22H14Cl2FNO2/c23-17-10-13(9-16-15-6-2-4-8-20(15)26-22(16)27)11-18(24)21(17)28-12-14-5-1-3-7-19(14)25/h1-11H,12H2,(H,26,27)/b16-9-.
What are the key properties of (3Z)-3-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one?
(3Z)-3-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one has a molecular weight of 414.26 g/mol, XLogP of 6.20, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one is sourced from PubChem (CID 6512038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).