C14H26F3NO2 — CID 65120803
4,4-dimethyl-1-[[3-(2,2,2-trifluoroethoxy)propylamino]methyl]cyclohexan-1-ol (PubChem CID 65120803) has the molecular formula C14H26F3NO2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 4,4-dimethyl-1-[[3-(2,2,2-trifluoroethoxy)propylamino]methyl]cyclohexan-1-ol.
| Compound Name | 4,4-dimethyl-1-[[3-(2,2,2-trifluoroethoxy)propylamino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 65120803 |
| Molecular Formula | C14H26F3NO2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 4,4-dimethyl-1-[[3-(2,2,2-trifluoroethoxy)propylamino]methyl]cyclohexan-1-ol |
| SMILES | CC1(C)CCC(O)(CNCCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H26F3NO2/c1-12(2)4-6-13(19,7-5-12)10-18-8-3-9-20-11-14(15,16)17/h18-19H,3-11H2,1-2H3 |
| InChIKey | KFILEQWCXSFEPQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|