About 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]butanoic acid
2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]butanoic acid (PubChem CID 65121052) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]butanoic acid.
Analyze 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]butanoic acid?
The IUPAC name of 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]butanoic acid (CID 65121052) is 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]butanoic acid.
What is the SMILES notation for 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]butanoic acid?
The canonical SMILES for 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]butanoic acid is CCC(NCC1(O)CCC(C)(C)CC1)C(=O)O.
What is the InChIKey of 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]butanoic acid?
The InChIKey is ZRXABAYRBMZIJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3/c1-4-10(11(15)16)14-9-13(17)7-5-12(2,3)6-8-13/h10,14,17H,4-9H2,1-3H3,(H,15,16).
What are the key properties of 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]butanoic acid?
2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]butanoic acid has a molecular weight of 243.35 g/mol, XLogP of 1.77, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]butanoic acid is sourced from PubChem (CID 65121052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).