About methyl 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylsulfamoyl]propanoate
methyl 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylsulfamoyl]propanoate (PubChem CID 65121253) has the molecular formula C13H25NO5S
and a molecular weight of 307.41 g/mol. Its IUPAC name is methyl 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylsulfamoyl]propanoate.
Molecular Properties
| Compound Name | methyl 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylsulfamoyl]propanoate |
| PubChem CID | 65121253 |
| Molecular Formula | C13H25NO5S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | methyl 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylsulfamoyl]propanoate |
| SMILES | COC(=O)C(C)S(=O)(=O)NCC1(O)CCC(C)(C)CC1 |
| InChI | InChI=1S/C13H25NO5S/c1-10(11(15)19-4)20(17,18)14-9-13(16)7-5-12(2,3)6-8-13/h10,14,16H,5-9H2,1-4H3 |
| InChIKey | VURZMRMWESUCEO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylsulfamoyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylsulfamoyl]propanoate?
The IUPAC name of methyl 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylsulfamoyl]propanoate (CID 65121253) is methyl 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylsulfamoyl]propanoate.
What is the SMILES notation for methyl 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylsulfamoyl]propanoate?
The canonical SMILES for methyl 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylsulfamoyl]propanoate is COC(=O)C(C)S(=O)(=O)NCC1(O)CCC(C)(C)CC1.
What is the InChIKey of methyl 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylsulfamoyl]propanoate?
The InChIKey is VURZMRMWESUCEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO5S/c1-10(11(15)19-4)20(17,18)14-9-13(16)7-5-12(2,3)6-8-13/h10,14,16H,5-9H2,1-4H3.
What are the key properties of methyl 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylsulfamoyl]propanoate?
methyl 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylsulfamoyl]propanoate has a molecular weight of 307.41 g/mol, XLogP of 0.80, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methylsulfamoyl]propanoate is sourced from PubChem (CID 65121253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).