About 1-[[[butyl(methyl)sulfamoyl]amino]methyl]-1-hydroxy-4,4-dimethylcyclohexane
1-[[[butyl(methyl)sulfamoyl]amino]methyl]-1-hydroxy-4,4-dimethylcyclohexane (PubChem CID 65121349) has the molecular formula C14H30N2O3S
and a molecular weight of 306.47 g/mol. Its IUPAC name is 1-[[[butyl(methyl)sulfamoyl]amino]methyl]-1-hydroxy-4,4-dimethylcyclohexane.
Molecular Properties
| Compound Name | 1-[[[butyl(methyl)sulfamoyl]amino]methyl]-1-hydroxy-4,4-dimethylcyclohexane |
| PubChem CID | 65121349 |
| Molecular Formula | C14H30N2O3S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 1-[[[butyl(methyl)sulfamoyl]amino]methyl]-1-hydroxy-4,4-dimethylcyclohexane |
| SMILES | CCCCN(C)S(=O)(=O)NCC1(O)CCC(C)(C)CC1 |
| InChI | InChI=1S/C14H30N2O3S/c1-5-6-11-16(4)20(18,19)15-12-14(17)9-7-13(2,3)8-10-14/h15,17H,5-12H2,1-4H3 |
| InChIKey | YWEJWOHIGNRYIG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[[butyl(methyl)sulfamoyl]amino]methyl]-1-hydroxy-4,4-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[[butyl(methyl)sulfamoyl]amino]methyl]-1-hydroxy-4,4-dimethylcyclohexane?
The IUPAC name of 1-[[[butyl(methyl)sulfamoyl]amino]methyl]-1-hydroxy-4,4-dimethylcyclohexane (CID 65121349) is 1-[[[butyl(methyl)sulfamoyl]amino]methyl]-1-hydroxy-4,4-dimethylcyclohexane.
What is the SMILES notation for 1-[[[butyl(methyl)sulfamoyl]amino]methyl]-1-hydroxy-4,4-dimethylcyclohexane?
The canonical SMILES for 1-[[[butyl(methyl)sulfamoyl]amino]methyl]-1-hydroxy-4,4-dimethylcyclohexane is CCCCN(C)S(=O)(=O)NCC1(O)CCC(C)(C)CC1.
What is the InChIKey of 1-[[[butyl(methyl)sulfamoyl]amino]methyl]-1-hydroxy-4,4-dimethylcyclohexane?
The InChIKey is YWEJWOHIGNRYIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2O3S/c1-5-6-11-16(4)20(18,19)15-12-14(17)9-7-13(2,3)8-10-14/h15,17H,5-12H2,1-4H3.
What are the key properties of 1-[[[butyl(methyl)sulfamoyl]amino]methyl]-1-hydroxy-4,4-dimethylcyclohexane?
1-[[[butyl(methyl)sulfamoyl]amino]methyl]-1-hydroxy-4,4-dimethylcyclohexane has a molecular weight of 306.47 g/mol, XLogP of 1.88, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[[butyl(methyl)sulfamoyl]amino]methyl]-1-hydroxy-4,4-dimethylcyclohexane is sourced from PubChem (CID 65121349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).