C17H25NO3 — CID 65121895
2-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 65121895) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 65121895 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC1(C)CCC(O)(CN2C(=O)C3CC=CCC3C2=O)CC1 |
| InChI | InChI=1S/C17H25NO3/c1-16(2)7-9-17(21,10-8-16)11-18-14(19)12-5-3-4-6-13(12)15(18)20/h3-4,12-13,21H,5-11H2,1-2H3 |
| InChIKey | YJCRILKCFKZZEX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|