C14H19BrFNO3S — CID 65122783
2-bromo-4-fluoro-N-[(1-hydroxycycloheptyl)methyl]benzenesulfonamide (PubChem CID 65122783) has the molecular formula C14H19BrFNO3S and a molecular weight of 380.28 g/mol. Its IUPAC name is 2-bromo-4-fluoro-N-[(1-hydroxycycloheptyl)methyl]benzenesulfonamide.
| Compound Name | 2-bromo-4-fluoro-N-[(1-hydroxycycloheptyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 65122783 |
| Molecular Formula | C14H19BrFNO3S |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 2-bromo-4-fluoro-N-[(1-hydroxycycloheptyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1(O)CCCCCC1)c1ccc(F)cc1Br |
| InChI | InChI=1S/C14H19BrFNO3S/c15-12-9-11(16)5-6-13(12)21(19,20)17-10-14(18)7-3-1-2-4-8-14/h5-6,9,17-18H,1-4,7-8,10H2 |
| InChIKey | RTJPIHLLGRACAD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |