C16H22N2O3 — CID 65123811
4-N-[(1-hydroxy-3-methylcyclohexyl)methyl]benzene-1,4-dicarboxamide (PubChem CID 65123811) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 4-N-[(1-hydroxy-3-methylcyclohexyl)methyl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[(1-hydroxy-3-methylcyclohexyl)methyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 65123811 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 4-N-[(1-hydroxy-3-methylcyclohexyl)methyl]benzene-1,4-dicarboxamide |
| SMILES | CC1CCCC(O)(CNC(=O)c2ccc(C(N)=O)cc2)C1 |
| InChI | InChI=1S/C16H22N2O3/c1-11-3-2-8-16(21,9-11)10-18-15(20)13-6-4-12(5-7-13)14(17)19/h4-7,11,21H,2-3,8-10H2,1H3,(H2,17,19)(H,18,20) |
| InChIKey | GOBIMGKMGVWPMQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |