C13H25NO2 — CID 65124264
N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-methylpropanamide (PubChem CID 65124264) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-methylpropanamide.
| Compound Name | N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 65124264 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-methylpropanamide |
| SMILES | CCC1CCC(O)(CNC(=O)C(C)C)CC1 |
| InChI | InChI=1S/C13H25NO2/c1-4-11-5-7-13(16,8-6-11)9-14-12(15)10(2)3/h10-11,16H,4-9H2,1-3H3,(H,14,15) |
| InChIKey | VGTQTDUANRCDFV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |