About 2-cyano-N-[(Z)-(1,2,5-trimethylpiperidin-4-ylidene)amino]acetamide
2-cyano-N-[(Z)-(1,2,5-trimethylpiperidin-4-ylidene)amino]acetamide (PubChem CID 6512528) has the molecular formula C11H18N4O
and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-cyano-N-[(Z)-(1,2,5-trimethylpiperidin-4-ylidene)amino]acetamide.
Molecular Properties
| Compound Name | 2-cyano-N-[(Z)-(1,2,5-trimethylpiperidin-4-ylidene)amino]acetamide |
| PubChem CID | 6512528 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 2-cyano-N-[(Z)-(1,2,5-trimethylpiperidin-4-ylidene)amino]acetamide |
| SMILES | CC1CN(C)C(C)C/C1=N/NC(=O)CC#N |
| InChI | InChI=1S/C11H18N4O/c1-8-7-15(3)9(2)6-10(8)13-14-11(16)4-5-12/h8-9H,4,6-7H2,1-3H3,(H,14,16)/b13-10- |
| InChIKey | BVTYFBFFNMPTEC-RAXLEYEMSA-N |
| XLogP | 0.73 |
| TPSA | 68.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-N-[(Z)-(1,2,5-trimethylpiperidin-4-ylidene)amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-[(Z)-(1,2,5-trimethylpiperidin-4-ylidene)amino]acetamide?
The IUPAC name of 2-cyano-N-[(Z)-(1,2,5-trimethylpiperidin-4-ylidene)amino]acetamide (CID 6512528) is 2-cyano-N-[(Z)-(1,2,5-trimethylpiperidin-4-ylidene)amino]acetamide.
What is the SMILES notation for 2-cyano-N-[(Z)-(1,2,5-trimethylpiperidin-4-ylidene)amino]acetamide?
The canonical SMILES for 2-cyano-N-[(Z)-(1,2,5-trimethylpiperidin-4-ylidene)amino]acetamide is CC1CN(C)C(C)C/C1=N/NC(=O)CC#N.
What is the InChIKey of 2-cyano-N-[(Z)-(1,2,5-trimethylpiperidin-4-ylidene)amino]acetamide?
The InChIKey is BVTYFBFFNMPTEC-RAXLEYEMSA-N. The full InChI is InChI=1S/C11H18N4O/c1-8-7-15(3)9(2)6-10(8)13-14-11(16)4-5-12/h8-9H,4,6-7H2,1-3H3,(H,14,16)/b13-10-.
What are the key properties of 2-cyano-N-[(Z)-(1,2,5-trimethylpiperidin-4-ylidene)amino]acetamide?
2-cyano-N-[(Z)-(1,2,5-trimethylpiperidin-4-ylidene)amino]acetamide has a molecular weight of 222.29 g/mol, XLogP of 0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-[(Z)-(1,2,5-trimethylpiperidin-4-ylidene)amino]acetamide is sourced from PubChem (CID 6512528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).