C15H16BrClN2O — CID 65125681
N-[[5-bromo-2-[(3-chlorophenyl)methoxy]-3-pyridinyl]methyl]ethanamine (PubChem CID 65125681) has the molecular formula C15H16BrClN2O and a molecular weight of 355.66 g/mol. Its IUPAC name is N-[[5-bromo-2-[(3-chlorophenyl)methoxy]-3-pyridinyl]methyl]ethanamine.
| Compound Name | N-[[5-bromo-2-[(3-chlorophenyl)methoxy]-3-pyridinyl]methyl]ethanamine |
|---|---|
| PubChem CID | 65125681 |
| Molecular Formula | C15H16BrClN2O |
| Molecular Weight | 355.66 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | N-[[5-bromo-2-[(3-chlorophenyl)methoxy]-3-pyridinyl]methyl]ethanamine |
| SMILES | CCNCc1cc(Br)cnc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H16BrClN2O/c1-2-18-8-12-7-13(16)9-19-15(12)20-10-11-4-3-5-14(17)6-11/h3-7,9,18H,2,8,10H2,1H3 |
| InChIKey | UXDSJEJKOLUZCJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.66 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |