C16H20ClNO2 — CID 65125800
N-[[5-[(4-chlorophenyl)methoxymethyl]-2-methylfuran-3-yl]methyl]ethanamine (PubChem CID 65125800) has the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. Its IUPAC name is N-[[5-[(4-chlorophenyl)methoxymethyl]-2-methylfuran-3-yl]methyl]ethanamine.
| Compound Name | N-[[5-[(4-chlorophenyl)methoxymethyl]-2-methylfuran-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 65125800 |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-[[5-[(4-chlorophenyl)methoxymethyl]-2-methylfuran-3-yl]methyl]ethanamine |
| SMILES | CCNCc1cc(COCc2ccc(Cl)cc2)oc1C |
| InChI | InChI=1S/C16H20ClNO2/c1-3-18-9-14-8-16(20-12(14)2)11-19-10-13-4-6-15(17)7-5-13/h4-8,18H,3,9-11H2,1-2H3 |
| InChIKey | NYQIMVOLHHCWJN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |