About cyclohexyl 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate
cyclohexyl 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate (PubChem CID 651260) has the molecular formula C17H20N2O4
and a molecular weight of 316.36 g/mol. Its IUPAC name is cyclohexyl 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate.
Molecular Properties
| Compound Name | cyclohexyl 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate |
| PubChem CID | 651260 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | cyclohexyl 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate |
| SMILES | O=C(CCn1[nH]c(=O)c2ccccc2c1=O)OC1CCCCC1 |
| InChI | InChI=1S/C17H20N2O4/c20-15(23-12-6-2-1-3-7-12)10-11-19-17(22)14-9-5-4-8-13(14)16(21)18-19/h4-5,8-9,12H,1-3,6-7,10-11H2,(H,18,21) |
| InChIKey | KXVAOSVMOONRFR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohexyl 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate?
The IUPAC name of cyclohexyl 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate (CID 651260) is cyclohexyl 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate.
What is the SMILES notation for cyclohexyl 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate?
The canonical SMILES for cyclohexyl 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate is O=C(CCn1[nH]c(=O)c2ccccc2c1=O)OC1CCCCC1.
What is the InChIKey of cyclohexyl 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate?
The InChIKey is KXVAOSVMOONRFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O4/c20-15(23-12-6-2-1-3-7-12)10-11-19-17(22)14-9-5-4-8-13(14)16(21)18-19/h4-5,8-9,12H,1-3,6-7,10-11H2,(H,18,21).
What are the key properties of cyclohexyl 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate?
cyclohexyl 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate has a molecular weight of 316.36 g/mol, XLogP of 1.96, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate is sourced from PubChem (CID 651260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).