C17H22N2S2 — CID 65128657
N-[[5-phenyl-2-(propylsulfanylmethyl)-1,3-thiazol-4-yl]methyl]cyclopropanamine (PubChem CID 65128657) has the molecular formula C17H22N2S2 and a molecular weight of 318.51 g/mol. Its IUPAC name is N-[[5-phenyl-2-(propylsulfanylmethyl)-1,3-thiazol-4-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-phenyl-2-(propylsulfanylmethyl)-1,3-thiazol-4-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 65128657 |
| Molecular Formula | C17H22N2S2 |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[[5-phenyl-2-(propylsulfanylmethyl)-1,3-thiazol-4-yl]methyl]cyclopropanamine |
| SMILES | CCCSCc1nc(CNC2CC2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C17H22N2S2/c1-2-10-20-12-16-19-15(11-18-14-8-9-14)17(21-16)13-6-4-3-5-7-13/h3-7,14,18H,2,8-12H2,1H3 |
| InChIKey | REHPNKKYXAZRLL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|