C11H18N2S2 — CID 65128825
2-(propylsulfanylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine (PubChem CID 65128825) has the molecular formula C11H18N2S2 and a molecular weight of 242.41 g/mol. Its IUPAC name is 2-(propylsulfanylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine.
| Compound Name | 2-(propylsulfanylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 65128825 |
| Molecular Formula | C11H18N2S2 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-(propylsulfanylmethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine |
| SMILES | CCCSCc1nc2c(s1)CCCC2N |
| InChI | InChI=1S/C11H18N2S2/c1-2-6-14-7-10-13-11-8(12)4-3-5-9(11)15-10/h8H,2-7,12H2,1H3 |
| InChIKey | NPWUYRCEPDXQRE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|