C12H14F2OS — CID 65129882
1-(2,3-difluorophenyl)-3-propylsulfanylpropan-2-one (PubChem CID 65129882) has the molecular formula C12H14F2OS and a molecular weight of 244.31 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-3-propylsulfanylpropan-2-one.
| Compound Name | 1-(2,3-difluorophenyl)-3-propylsulfanylpropan-2-one |
|---|---|
| PubChem CID | 65129882 |
| Molecular Formula | C12H14F2OS |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 1-(2,3-difluorophenyl)-3-propylsulfanylpropan-2-one |
| SMILES | CCCSCC(=O)Cc1cccc(F)c1F |
| InChI | InChI=1S/C12H14F2OS/c1-2-6-16-8-10(15)7-9-4-3-5-11(13)12(9)14/h3-5H,2,6-8H2,1H3 |
| InChIKey | OYWAGRFHFGKCNN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|