About 1-(3,5-difluorophenyl)-2-propylsulfanylethanol
1-(3,5-difluorophenyl)-2-propylsulfanylethanol (PubChem CID 65129891) has the molecular formula C11H14F2OS
and a molecular weight of 232.29 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-2-propylsulfanylethanol.
Molecular Properties
| Compound Name | 1-(3,5-difluorophenyl)-2-propylsulfanylethanol |
| PubChem CID | 65129891 |
| Molecular Formula | C11H14F2OS |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 1-(3,5-difluorophenyl)-2-propylsulfanylethanol |
| SMILES | CCCSCC(O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H14F2OS/c1-2-3-15-7-11(14)8-4-9(12)6-10(13)5-8/h4-6,11,14H,2-3,7H2,1H3 |
| InChIKey | DLGHTLCJMQHBOV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-difluorophenyl)-2-propylsulfanylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-difluorophenyl)-2-propylsulfanylethanol?
The IUPAC name of 1-(3,5-difluorophenyl)-2-propylsulfanylethanol (CID 65129891) is 1-(3,5-difluorophenyl)-2-propylsulfanylethanol.
What is the SMILES notation for 1-(3,5-difluorophenyl)-2-propylsulfanylethanol?
The canonical SMILES for 1-(3,5-difluorophenyl)-2-propylsulfanylethanol is CCCSCC(O)c1cc(F)cc(F)c1.
What is the InChIKey of 1-(3,5-difluorophenyl)-2-propylsulfanylethanol?
The InChIKey is DLGHTLCJMQHBOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2OS/c1-2-3-15-7-11(14)8-4-9(12)6-10(13)5-8/h4-6,11,14H,2-3,7H2,1H3.
What are the key properties of 1-(3,5-difluorophenyl)-2-propylsulfanylethanol?
1-(3,5-difluorophenyl)-2-propylsulfanylethanol has a molecular weight of 232.29 g/mol, XLogP of 3.14, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-difluorophenyl)-2-propylsulfanylethanol is sourced from PubChem (CID 65129891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).