About 1-ethylsulfanyl-3,3-dipropylcyclobutane-1-carbonitrile
1-ethylsulfanyl-3,3-dipropylcyclobutane-1-carbonitrile (PubChem CID 65130948) has the molecular formula C13H23NS
and a molecular weight of 225.40 g/mol. Its IUPAC name is 1-ethylsulfanyl-3,3-dipropylcyclobutane-1-carbonitrile.
Molecular Properties
| Compound Name | 1-ethylsulfanyl-3,3-dipropylcyclobutane-1-carbonitrile |
| PubChem CID | 65130948 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 1-ethylsulfanyl-3,3-dipropylcyclobutane-1-carbonitrile |
| SMILES | CCCC1(CCC)CC(C#N)(SCC)C1 |
| InChI | InChI=1S/C13H23NS/c1-4-7-12(8-5-2)9-13(10-12,11-14)15-6-3/h4-10H2,1-3H3 |
| InChIKey | CALANMREBROBOE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethylsulfanyl-3,3-dipropylcyclobutane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylsulfanyl-3,3-dipropylcyclobutane-1-carbonitrile?
The IUPAC name of 1-ethylsulfanyl-3,3-dipropylcyclobutane-1-carbonitrile (CID 65130948) is 1-ethylsulfanyl-3,3-dipropylcyclobutane-1-carbonitrile.
What is the SMILES notation for 1-ethylsulfanyl-3,3-dipropylcyclobutane-1-carbonitrile?
The canonical SMILES for 1-ethylsulfanyl-3,3-dipropylcyclobutane-1-carbonitrile is CCCC1(CCC)CC(C#N)(SCC)C1.
What is the InChIKey of 1-ethylsulfanyl-3,3-dipropylcyclobutane-1-carbonitrile?
The InChIKey is CALANMREBROBOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NS/c1-4-7-12(8-5-2)9-13(10-12,11-14)15-6-3/h4-10H2,1-3H3.
What are the key properties of 1-ethylsulfanyl-3,3-dipropylcyclobutane-1-carbonitrile?
1-ethylsulfanyl-3,3-dipropylcyclobutane-1-carbonitrile has a molecular weight of 225.40 g/mol, XLogP of 4.38, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylsulfanyl-3,3-dipropylcyclobutane-1-carbonitrile is sourced from PubChem (CID 65130948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).