About 1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-ol
1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-ol (PubChem CID 65132760) has the molecular formula C9H17F3OS
and a molecular weight of 230.29 g/mol. Its IUPAC name is 1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-ol.
Molecular Properties
| Compound Name | 1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-ol |
| PubChem CID | 65132760 |
| Molecular Formula | C9H17F3OS |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-ol |
| SMILES | CC(C)(C)SCC(O)CCC(F)(F)F |
| InChI | InChI=1S/C9H17F3OS/c1-8(2,3)14-6-7(13)4-5-9(10,11)12/h7,13H,4-6H2,1-3H3 |
| InChIKey | ZJFSMWKPWZMQDS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-ol?
The IUPAC name of 1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-ol (CID 65132760) is 1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-ol.
What is the SMILES notation for 1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-ol?
The canonical SMILES for 1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-ol is CC(C)(C)SCC(O)CCC(F)(F)F.
What is the InChIKey of 1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-ol?
The InChIKey is ZJFSMWKPWZMQDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3OS/c1-8(2,3)14-6-7(13)4-5-9(10,11)12/h7,13H,4-6H2,1-3H3.
What are the key properties of 1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-ol?
1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-ol has a molecular weight of 230.29 g/mol, XLogP of 3.22, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-ol is sourced from PubChem (CID 65132760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).