C15H22F3NOS — CID 65133009
2-tert-butylsulfanyl-N-ethyl-1-[2-(trifluoromethoxy)phenyl]ethanamine (PubChem CID 65133009) has the molecular formula C15H22F3NOS and a molecular weight of 321.41 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-N-ethyl-1-[2-(trifluoromethoxy)phenyl]ethanamine.
| Compound Name | 2-tert-butylsulfanyl-N-ethyl-1-[2-(trifluoromethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 65133009 |
| Molecular Formula | C15H22F3NOS |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 2-tert-butylsulfanyl-N-ethyl-1-[2-(trifluoromethoxy)phenyl]ethanamine |
| SMILES | CCNC(CSC(C)(C)C)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C15H22F3NOS/c1-5-19-12(10-21-14(2,3)4)11-8-6-7-9-13(11)20-15(16,17)18/h6-9,12,19H,5,10H2,1-4H3 |
| InChIKey | IWBFTTPOWLUXOI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |