C13H18OS — CID 65134221
1-(3,5-dimethylphenyl)-2-propan-2-ylsulfanylethanone (PubChem CID 65134221) has the molecular formula C13H18OS and a molecular weight of 222.35 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-propan-2-ylsulfanylethanone.
| Compound Name | 1-(3,5-dimethylphenyl)-2-propan-2-ylsulfanylethanone |
|---|---|
| PubChem CID | 65134221 |
| Molecular Formula | C13H18OS |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-propan-2-ylsulfanylethanone |
| SMILES | Cc1cc(C)cc(C(=O)CSC(C)C)c1 |
| InChI | InChI=1S/C13H18OS/c1-9(2)15-8-13(14)12-6-10(3)5-11(4)7-12/h5-7,9H,8H2,1-4H3 |
| InChIKey | KSHBPCLCVUKQOC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |