About 4-N-[(2-fluorophenyl)methyl]-4-N-(oxolan-2-ylmethyl)benzene-1,4-disulfonamide
4-N-[(2-fluorophenyl)methyl]-4-N-(oxolan-2-ylmethyl)benzene-1,4-disulfonamide (PubChem CID 651352) has the molecular formula C18H21FN2O5S2
and a molecular weight of 428.51 g/mol. Its IUPAC name is 4-N-[(2-fluorophenyl)methyl]-4-N-(oxolan-2-ylmethyl)benzene-1,4-disulfonamide.
Molecular Properties
| Compound Name | 4-N-[(2-fluorophenyl)methyl]-4-N-(oxolan-2-ylmethyl)benzene-1,4-disulfonamide |
| PubChem CID | 651352 |
| Molecular Formula | C18H21FN2O5S2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 4-N-[(2-fluorophenyl)methyl]-4-N-(oxolan-2-ylmethyl)benzene-1,4-disulfonamide |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)N(Cc2ccccc2F)CC2CCCO2)cc1 |
| InChI | InChI=1S/C18H21FN2O5S2/c19-18-6-2-1-4-14(18)12-21(13-15-5-3-11-26-15)28(24,25)17-9-7-16(8-10-17)27(20,22)23/h1-2,4,6-10,15H,3,5,11-13H2,(H2,20,22,23) |
| InChIKey | MNNCPOJHQHOHSV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N-[(2-fluorophenyl)methyl]-4-N-(oxolan-2-ylmethyl)benzene-1,4-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-[(2-fluorophenyl)methyl]-4-N-(oxolan-2-ylmethyl)benzene-1,4-disulfonamide?
The IUPAC name of 4-N-[(2-fluorophenyl)methyl]-4-N-(oxolan-2-ylmethyl)benzene-1,4-disulfonamide (CID 651352) is 4-N-[(2-fluorophenyl)methyl]-4-N-(oxolan-2-ylmethyl)benzene-1,4-disulfonamide.
What is the SMILES notation for 4-N-[(2-fluorophenyl)methyl]-4-N-(oxolan-2-ylmethyl)benzene-1,4-disulfonamide?
The canonical SMILES for 4-N-[(2-fluorophenyl)methyl]-4-N-(oxolan-2-ylmethyl)benzene-1,4-disulfonamide is NS(=O)(=O)c1ccc(S(=O)(=O)N(Cc2ccccc2F)CC2CCCO2)cc1.
What is the InChIKey of 4-N-[(2-fluorophenyl)methyl]-4-N-(oxolan-2-ylmethyl)benzene-1,4-disulfonamide?
The InChIKey is MNNCPOJHQHOHSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21FN2O5S2/c19-18-6-2-1-4-14(18)12-21(13-15-5-3-11-26-15)28(24,25)17-9-7-16(8-10-17)27(20,22)23/h1-2,4,6-10,15H,3,5,11-13H2,(H2,20,22,23).
What are the key properties of 4-N-[(2-fluorophenyl)methyl]-4-N-(oxolan-2-ylmethyl)benzene-1,4-disulfonamide?
4-N-[(2-fluorophenyl)methyl]-4-N-(oxolan-2-ylmethyl)benzene-1,4-disulfonamide has a molecular weight of 428.51 g/mol, XLogP of 1.84, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-[(2-fluorophenyl)methyl]-4-N-(oxolan-2-ylmethyl)benzene-1,4-disulfonamide is sourced from PubChem (CID 651352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).