About 2-cyanoethyl (1Z)-N-(methylcarbamoyloxy)ethanimidothioate
2-cyanoethyl (1Z)-N-(methylcarbamoyloxy)ethanimidothioate (PubChem CID 6513641) has the molecular formula C7H11N3O2S
and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-cyanoethyl (1Z)-N-(methylcarbamoyloxy)ethanimidothioate.
Molecular Properties
| Compound Name | 2-cyanoethyl (1Z)-N-(methylcarbamoyloxy)ethanimidothioate |
| PubChem CID | 6513641 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2-cyanoethyl (1Z)-N-(methylcarbamoyloxy)ethanimidothioate |
| SMILES | CNC(=O)O/N=C(/C)SCCC#N |
| InChI | InChI=1S/C7H11N3O2S/c1-6(13-5-3-4-8)10-12-7(11)9-2/h3,5H2,1-2H3,(H,9,11)/b10-6- |
| InChIKey | IWRFWZPCCDGEFJ-POHAHGRESA-N |
| XLogP | 1.32 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoethyl (1Z)-N-(methylcarbamoyloxy)ethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethyl (1Z)-N-(methylcarbamoyloxy)ethanimidothioate?
The IUPAC name of 2-cyanoethyl (1Z)-N-(methylcarbamoyloxy)ethanimidothioate (CID 6513641) is 2-cyanoethyl (1Z)-N-(methylcarbamoyloxy)ethanimidothioate.
What is the SMILES notation for 2-cyanoethyl (1Z)-N-(methylcarbamoyloxy)ethanimidothioate?
The canonical SMILES for 2-cyanoethyl (1Z)-N-(methylcarbamoyloxy)ethanimidothioate is CNC(=O)O/N=C(/C)SCCC#N.
What is the InChIKey of 2-cyanoethyl (1Z)-N-(methylcarbamoyloxy)ethanimidothioate?
The InChIKey is IWRFWZPCCDGEFJ-POHAHGRESA-N. The full InChI is InChI=1S/C7H11N3O2S/c1-6(13-5-3-4-8)10-12-7(11)9-2/h3,5H2,1-2H3,(H,9,11)/b10-6-.
What are the key properties of 2-cyanoethyl (1Z)-N-(methylcarbamoyloxy)ethanimidothioate?
2-cyanoethyl (1Z)-N-(methylcarbamoyloxy)ethanimidothioate has a molecular weight of 201.25 g/mol, XLogP of 1.32, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethyl (1Z)-N-(methylcarbamoyloxy)ethanimidothioate is sourced from PubChem (CID 6513641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).