About 2-(2-methylpropylsulfanyl)-N'-propylethanimidamide
2-(2-methylpropylsulfanyl)-N'-propylethanimidamide (PubChem CID 65137142) has the molecular formula C9H20N2S
and a molecular weight of 188.34 g/mol. Its IUPAC name is 2-(2-methylpropylsulfanyl)-N'-propylethanimidamide.
Molecular Properties
| Compound Name | 2-(2-methylpropylsulfanyl)-N'-propylethanimidamide |
| PubChem CID | 65137142 |
| Molecular Formula | C9H20N2S |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-(2-methylpropylsulfanyl)-N'-propylethanimidamide |
| SMILES | CCC/N=C(/N)CSCC(C)C |
| InChI | InChI=1S/C9H20N2S/c1-4-5-11-9(10)7-12-6-8(2)3/h8H,4-7H2,1-3H3,(H2,10,11) |
| InChIKey | WJXYTXWVPIWDNV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylpropylsulfanyl)-N'-propylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropylsulfanyl)-N'-propylethanimidamide?
The IUPAC name of 2-(2-methylpropylsulfanyl)-N'-propylethanimidamide (CID 65137142) is 2-(2-methylpropylsulfanyl)-N'-propylethanimidamide.
What is the SMILES notation for 2-(2-methylpropylsulfanyl)-N'-propylethanimidamide?
The canonical SMILES for 2-(2-methylpropylsulfanyl)-N'-propylethanimidamide is CCC/N=C(/N)CSCC(C)C.
What is the InChIKey of 2-(2-methylpropylsulfanyl)-N'-propylethanimidamide?
The InChIKey is WJXYTXWVPIWDNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2S/c1-4-5-11-9(10)7-12-6-8(2)3/h8H,4-7H2,1-3H3,(H2,10,11).
What are the key properties of 2-(2-methylpropylsulfanyl)-N'-propylethanimidamide?
2-(2-methylpropylsulfanyl)-N'-propylethanimidamide has a molecular weight of 188.34 g/mol, XLogP of 2.14, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropylsulfanyl)-N'-propylethanimidamide is sourced from PubChem (CID 65137142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).