C14H20FNS — CID 65138724
2-cyclopentylsulfanyl-1-(4-fluorophenyl)-N-methylethanamine (PubChem CID 65138724) has the molecular formula C14H20FNS and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-1-(4-fluorophenyl)-N-methylethanamine.
| Compound Name | 2-cyclopentylsulfanyl-1-(4-fluorophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 65138724 |
| Molecular Formula | C14H20FNS |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-cyclopentylsulfanyl-1-(4-fluorophenyl)-N-methylethanamine |
| SMILES | CNC(CSC1CCCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H20FNS/c1-16-14(10-17-13-4-2-3-5-13)11-6-8-12(15)9-7-11/h6-9,13-14,16H,2-5,10H2,1H3 |
| InChIKey | RUOGCRSFUNSBRJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |