C12H15ClN2OS — CID 65138738
1-(2-amino-5-chloro-3-pyridinyl)-2-cyclopentylsulfanylethanone (PubChem CID 65138738) has the molecular formula C12H15ClN2OS and a molecular weight of 270.78 g/mol. Its IUPAC name is 1-(2-amino-5-chloro-3-pyridinyl)-2-cyclopentylsulfanylethanone.
| Compound Name | 1-(2-amino-5-chloro-3-pyridinyl)-2-cyclopentylsulfanylethanone |
|---|---|
| PubChem CID | 65138738 |
| Molecular Formula | C12H15ClN2OS |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 1-(2-amino-5-chloro-3-pyridinyl)-2-cyclopentylsulfanylethanone |
| SMILES | Nc1ncc(Cl)cc1C(=O)CSC1CCCC1 |
| InChI | InChI=1S/C12H15ClN2OS/c13-8-5-10(12(14)15-6-8)11(16)7-17-9-3-1-2-4-9/h5-6,9H,1-4,7H2,(H2,14,15) |
| InChIKey | RGPGIDFLTHEHEX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |