C17H24OS — CID 65139009
1-cyclopentylsulfanyl-3-(4-propan-2-ylphenyl)propan-2-one (PubChem CID 65139009) has the molecular formula C17H24OS and a molecular weight of 276.45 g/mol. Its IUPAC name is 1-cyclopentylsulfanyl-3-(4-propan-2-ylphenyl)propan-2-one.
| Compound Name | 1-cyclopentylsulfanyl-3-(4-propan-2-ylphenyl)propan-2-one |
|---|---|
| PubChem CID | 65139009 |
| Molecular Formula | C17H24OS |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 1-cyclopentylsulfanyl-3-(4-propan-2-ylphenyl)propan-2-one |
| SMILES | CC(C)c1ccc(CC(=O)CSC2CCCC2)cc1 |
| InChI | InChI=1S/C17H24OS/c1-13(2)15-9-7-14(8-10-15)11-16(18)12-19-17-5-3-4-6-17/h7-10,13,17H,3-6,11-12H2,1-2H3 |
| InChIKey | ADJQCNTXGXXXEB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |