C14H18N2O — CID 6513919
(NZ)-N-(1-piperidin-1-yl-1,3-dihydroinden-2-ylidene)hydroxylamine (PubChem CID 6513919) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is (NZ)-N-(1-piperidin-1-yl-1,3-dihydroinden-2-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(1-piperidin-1-yl-1,3-dihydroinden-2-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 6513919 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (NZ)-N-(1-piperidin-1-yl-1,3-dihydroinden-2-ylidene)hydroxylamine |
| SMILES | O/N=C1/Cc2ccccc2C1N1CCCCC1 |
| InChI | InChI=1S/C14H18N2O/c17-15-13-10-11-6-2-3-7-12(11)14(13)16-8-4-1-5-9-16/h2-3,6-7,14,17H,1,4-5,8-10H2/b15-13- |
| InChIKey | JMUXAWIENGARML-SQFISAMPSA-N |
| XLogP | 2.60 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|