C17H27NOS — CID 65139316
1-cyclopentylsulfanyl-N-ethyl-3-(3-methoxyphenyl)propan-2-amine (PubChem CID 65139316) has the molecular formula C17H27NOS and a molecular weight of 293.48 g/mol. Its IUPAC name is 1-cyclopentylsulfanyl-N-ethyl-3-(3-methoxyphenyl)propan-2-amine.
| Compound Name | 1-cyclopentylsulfanyl-N-ethyl-3-(3-methoxyphenyl)propan-2-amine |
|---|---|
| PubChem CID | 65139316 |
| Molecular Formula | C17H27NOS |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 1-cyclopentylsulfanyl-N-ethyl-3-(3-methoxyphenyl)propan-2-amine |
| SMILES | CCNC(CSC1CCCC1)Cc1cccc(OC)c1 |
| InChI | InChI=1S/C17H27NOS/c1-3-18-15(13-20-17-9-4-5-10-17)11-14-7-6-8-16(12-14)19-2/h6-8,12,15,17-18H,3-5,9-11,13H2,1-2H3 |
| InChIKey | NFRZDRBQSQRJQH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |