C17H27NS — CID 65139652
2-cyclohexylsulfanyl-1-(2,4,5-trimethylphenyl)ethanamine (PubChem CID 65139652) has the molecular formula C17H27NS and a molecular weight of 277.48 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-1-(2,4,5-trimethylphenyl)ethanamine.
| Compound Name | 2-cyclohexylsulfanyl-1-(2,4,5-trimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 65139652 |
| Molecular Formula | C17H27NS |
| Molecular Weight | 277.48 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 2-cyclohexylsulfanyl-1-(2,4,5-trimethylphenyl)ethanamine |
| SMILES | Cc1cc(C)c(C(N)CSC2CCCCC2)cc1C |
| InChI | InChI=1S/C17H27NS/c1-12-9-14(3)16(10-13(12)2)17(18)11-19-15-7-5-4-6-8-15/h9-10,15,17H,4-8,11,18H2,1-3H3 |
| InChIKey | UTJCQFVIMOIEIX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |