About 1-cyclohexylsulfanyl-N,4-dimethylhexan-2-amine
1-cyclohexylsulfanyl-N,4-dimethylhexan-2-amine (PubChem CID 65139959) has the molecular formula C14H29NS
and a molecular weight of 243.46 g/mol. Its IUPAC name is 1-cyclohexylsulfanyl-N,4-dimethylhexan-2-amine.
Molecular Properties
| Compound Name | 1-cyclohexylsulfanyl-N,4-dimethylhexan-2-amine |
| PubChem CID | 65139959 |
| Molecular Formula | C14H29NS |
| Molecular Weight | 243.46 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 1-cyclohexylsulfanyl-N,4-dimethylhexan-2-amine |
| SMILES | CCC(C)CC(CSC1CCCCC1)NC |
| InChI | InChI=1S/C14H29NS/c1-4-12(2)10-13(15-3)11-16-14-8-6-5-7-9-14/h12-15H,4-11H2,1-3H3 |
| InChIKey | FKAIOBPMNLVSJB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexylsulfanyl-N,4-dimethylhexan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylsulfanyl-N,4-dimethylhexan-2-amine?
The IUPAC name of 1-cyclohexylsulfanyl-N,4-dimethylhexan-2-amine (CID 65139959) is 1-cyclohexylsulfanyl-N,4-dimethylhexan-2-amine.
What is the SMILES notation for 1-cyclohexylsulfanyl-N,4-dimethylhexan-2-amine?
The canonical SMILES for 1-cyclohexylsulfanyl-N,4-dimethylhexan-2-amine is CCC(C)CC(CSC1CCCCC1)NC.
What is the InChIKey of 1-cyclohexylsulfanyl-N,4-dimethylhexan-2-amine?
The InChIKey is FKAIOBPMNLVSJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NS/c1-4-12(2)10-13(15-3)11-16-14-8-6-5-7-9-14/h12-15H,4-11H2,1-3H3.
What are the key properties of 1-cyclohexylsulfanyl-N,4-dimethylhexan-2-amine?
1-cyclohexylsulfanyl-N,4-dimethylhexan-2-amine has a molecular weight of 243.46 g/mol, XLogP of 4.08, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylsulfanyl-N,4-dimethylhexan-2-amine is sourced from PubChem (CID 65139959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).