About 2-cyclopentylsulfanyl-N,N-dimethylethanimidamide
2-cyclopentylsulfanyl-N,N-dimethylethanimidamide (PubChem CID 65140702) has the molecular formula C9H18N2S
and a molecular weight of 186.32 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-N,N-dimethylethanimidamide.
Molecular Properties
| Compound Name | 2-cyclopentylsulfanyl-N,N-dimethylethanimidamide |
| PubChem CID | 65140702 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-cyclopentylsulfanyl-N,N-dimethylethanimidamide |
| SMILES | [H]/N=C(/CSC1CCCC1)N(C)C |
| InChI | InChI=1S/C9H18N2S/c1-11(2)9(10)7-12-8-5-3-4-6-8/h8,10H,3-7H2,1-2H3/b10-9- |
| InChIKey | PXTTWCKTGPOCFT-KTKRTIGZSA-N |
| XLogP | 2.20 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopentylsulfanyl-N,N-dimethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentylsulfanyl-N,N-dimethylethanimidamide?
The IUPAC name of 2-cyclopentylsulfanyl-N,N-dimethylethanimidamide (CID 65140702) is 2-cyclopentylsulfanyl-N,N-dimethylethanimidamide.
What is the SMILES notation for 2-cyclopentylsulfanyl-N,N-dimethylethanimidamide?
The canonical SMILES for 2-cyclopentylsulfanyl-N,N-dimethylethanimidamide is [H]/N=C(/CSC1CCCC1)N(C)C.
What is the InChIKey of 2-cyclopentylsulfanyl-N,N-dimethylethanimidamide?
The InChIKey is PXTTWCKTGPOCFT-KTKRTIGZSA-N. The full InChI is InChI=1S/C9H18N2S/c1-11(2)9(10)7-12-8-5-3-4-6-8/h8,10H,3-7H2,1-2H3/b10-9-.
What are the key properties of 2-cyclopentylsulfanyl-N,N-dimethylethanimidamide?
2-cyclopentylsulfanyl-N,N-dimethylethanimidamide has a molecular weight of 186.32 g/mol, XLogP of 2.20, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentylsulfanyl-N,N-dimethylethanimidamide is sourced from PubChem (CID 65140702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).