About 1-[2-(butan-2-ylsulfanylmethyl)-1,3-thiazol-5-yl]ethanol
1-[2-(butan-2-ylsulfanylmethyl)-1,3-thiazol-5-yl]ethanol (PubChem CID 65141390) has the molecular formula C10H17NOS2
and a molecular weight of 231.39 g/mol. Its IUPAC name is 1-[2-(butan-2-ylsulfanylmethyl)-1,3-thiazol-5-yl]ethanol.
Molecular Properties
| Compound Name | 1-[2-(butan-2-ylsulfanylmethyl)-1,3-thiazol-5-yl]ethanol |
| PubChem CID | 65141390 |
| Molecular Formula | C10H17NOS2 |
| Molecular Weight | 231.39 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 1-[2-(butan-2-ylsulfanylmethyl)-1,3-thiazol-5-yl]ethanol |
| SMILES | CCC(C)SCc1ncc(C(C)O)s1 |
| InChI | InChI=1S/C10H17NOS2/c1-4-7(2)13-6-10-11-5-9(14-10)8(3)12/h5,7-8,12H,4,6H2,1-3H3 |
| InChIKey | OGXHYMRAPSIUDC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(butan-2-ylsulfanylmethyl)-1,3-thiazol-5-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(butan-2-ylsulfanylmethyl)-1,3-thiazol-5-yl]ethanol?
The IUPAC name of 1-[2-(butan-2-ylsulfanylmethyl)-1,3-thiazol-5-yl]ethanol (CID 65141390) is 1-[2-(butan-2-ylsulfanylmethyl)-1,3-thiazol-5-yl]ethanol.
What is the SMILES notation for 1-[2-(butan-2-ylsulfanylmethyl)-1,3-thiazol-5-yl]ethanol?
The canonical SMILES for 1-[2-(butan-2-ylsulfanylmethyl)-1,3-thiazol-5-yl]ethanol is CCC(C)SCc1ncc(C(C)O)s1.
What is the InChIKey of 1-[2-(butan-2-ylsulfanylmethyl)-1,3-thiazol-5-yl]ethanol?
The InChIKey is OGXHYMRAPSIUDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NOS2/c1-4-7(2)13-6-10-11-5-9(14-10)8(3)12/h5,7-8,12H,4,6H2,1-3H3.
What are the key properties of 1-[2-(butan-2-ylsulfanylmethyl)-1,3-thiazol-5-yl]ethanol?
1-[2-(butan-2-ylsulfanylmethyl)-1,3-thiazol-5-yl]ethanol has a molecular weight of 231.39 g/mol, XLogP of 3.23, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(butan-2-ylsulfanylmethyl)-1,3-thiazol-5-yl]ethanol is sourced from PubChem (CID 65141390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).