C13H26N2O4S — CID 65142558
tert-butyl 2-[2-(methanesulfonamido)ethyl]piperidine-1-carboxylate (PubChem CID 65142558) has the molecular formula C13H26N2O4S and a molecular weight of 306.43 g/mol. Its IUPAC name is tert-butyl 2-[2-(methanesulfonamido)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(methanesulfonamido)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 65142558 |
| Molecular Formula | C13H26N2O4S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | tert-butyl 2-[2-(methanesulfonamido)ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1CCNS(C)(=O)=O |
| InChI | InChI=1S/C13H26N2O4S/c1-13(2,3)19-12(16)15-10-6-5-7-11(15)8-9-14-20(4,17)18/h11,14H,5-10H2,1-4H3 |
| InChIKey | BPLSBUDISDWVIX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |