C14H25N3O2 — CID 65142849
tert-butyl N-(1-imidazol-1-yl-3,3-dimethylbutan-2-yl)carbamate (PubChem CID 65142849) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is tert-butyl N-(1-imidazol-1-yl-3,3-dimethylbutan-2-yl)carbamate.
| Compound Name | tert-butyl N-(1-imidazol-1-yl-3,3-dimethylbutan-2-yl)carbamate |
|---|---|
| PubChem CID | 65142849 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | tert-butyl N-(1-imidazol-1-yl-3,3-dimethylbutan-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cn1ccnc1)C(C)(C)C |
| InChI | InChI=1S/C14H25N3O2/c1-13(2,3)11(9-17-8-7-15-10-17)16-12(18)19-14(4,5)6/h7-8,10-11H,9H2,1-6H3,(H,16,18) |
| InChIKey | VTIUFLJZXMIIST-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |