C16H23F2NS — CID 65144292
2-cyclohexylsulfanyl-1-(2,4-difluorophenyl)-N-ethylethanamine (PubChem CID 65144292) has the molecular formula C16H23F2NS and a molecular weight of 299.43 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-1-(2,4-difluorophenyl)-N-ethylethanamine.
| Compound Name | 2-cyclohexylsulfanyl-1-(2,4-difluorophenyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 65144292 |
| Molecular Formula | C16H23F2NS |
| Molecular Weight | 299.43 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-cyclohexylsulfanyl-1-(2,4-difluorophenyl)-N-ethylethanamine |
| SMILES | CCNC(CSC1CCCCC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H23F2NS/c1-2-19-16(11-20-13-6-4-3-5-7-13)14-9-8-12(17)10-15(14)18/h8-10,13,16,19H,2-7,11H2,1H3 |
| InChIKey | HZNXJMPTBUPQQV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |