About (3E)-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one
(3E)-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one (PubChem CID 6514539) has the molecular formula C18H14N2O
and a molecular weight of 274.32 g/mol. Its IUPAC name is (3E)-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one.
Molecular Properties
| Compound Name | (3E)-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one |
| PubChem CID | 6514539 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (3E)-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one |
| SMILES | O=c1c2ccccc2nc2n1CC/C2=C\c1ccccc1 |
| InChI | InChI=1S/C18H14N2O/c21-18-15-8-4-5-9-16(15)19-17-14(10-11-20(17)18)12-13-6-2-1-3-7-13/h1-9,12H,10-11H2/b14-12+ |
| InChIKey | SMIVDYUWPSDRLK-WYMLVPIESA-N |
| XLogP | 3.34 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3E)-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one?
The IUPAC name of (3E)-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one (CID 6514539) is (3E)-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one.
What is the SMILES notation for (3E)-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one?
The canonical SMILES for (3E)-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one is O=c1c2ccccc2nc2n1CC/C2=C\c1ccccc1.
What is the InChIKey of (3E)-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one?
The InChIKey is SMIVDYUWPSDRLK-WYMLVPIESA-N. The full InChI is InChI=1S/C18H14N2O/c21-18-15-8-4-5-9-16(15)19-17-14(10-11-20(17)18)12-13-6-2-1-3-7-13/h1-9,12H,10-11H2/b14-12+.
What are the key properties of (3E)-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one?
(3E)-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one has a molecular weight of 274.32 g/mol, XLogP of 3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one is sourced from PubChem (CID 6514539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).