C18H27ClO2 — CID 65147543
2-tert-butyl-1-[(5-chloro-2-methoxyphenyl)methyl]cyclohexan-1-ol (PubChem CID 65147543) has the molecular formula C18H27ClO2 and a molecular weight of 310.86 g/mol. Its IUPAC name is 2-tert-butyl-1-[(5-chloro-2-methoxyphenyl)methyl]cyclohexan-1-ol.
| Compound Name | 2-tert-butyl-1-[(5-chloro-2-methoxyphenyl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 65147543 |
| Molecular Formula | C18H27ClO2 |
| Molecular Weight | 310.86 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-tert-butyl-1-[(5-chloro-2-methoxyphenyl)methyl]cyclohexan-1-ol |
| SMILES | COc1ccc(Cl)cc1CC1(O)CCCCC1C(C)(C)C |
| InChI | InChI=1S/C18H27ClO2/c1-17(2,3)16-7-5-6-10-18(16,20)12-13-11-14(19)8-9-15(13)21-4/h8-9,11,16,20H,5-7,10,12H2,1-4H3 |
| InChIKey | KGPJCYCISJNBSQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.86 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |