C28H27N5O5 — CID 6514803
(5Z)-1-benzyl-5-[[2,5-dimethyl-1-(3-nitro-4-pyrrolidin-1-ylphenyl)pyrrol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 6514803) has the molecular formula C28H27N5O5 and a molecular weight of 513.55 g/mol. Its IUPAC name is (5Z)-1-benzyl-5-[[2,5-dimethyl-1-(3-nitro-4-pyrrolidin-1-ylphenyl)pyrrol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-benzyl-5-[[2,5-dimethyl-1-(3-nitro-4-pyrrolidin-1-ylphenyl)pyrrol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6514803 |
| Molecular Formula | C28H27N5O5 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | (5Z)-1-benzyl-5-[[2,5-dimethyl-1-(3-nitro-4-pyrrolidin-1-ylphenyl)pyrrol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1cc(/C=C2/C(=O)NC(=O)N(Cc3ccccc3)C2=O)c(C)n1-c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H27N5O5/c1-18-14-21(15-23-26(34)29-28(36)31(27(23)35)17-20-8-4-3-5-9-20)19(2)32(18)22-10-11-24(25(16-22)33(37)38)30-12-6-7-13-30/h3-5,8-11,14-16H,6-7,12-13,17H2,1-2H3,(H,29,34,36)/b23-15- |
| InChIKey | PWTSWNCSZDUFJB-HAHDFKILSA-N |
| XLogP | 4.26 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|