C14H10BrF3O — CID 65148052
1-(3-bromo-4-fluorophenyl)-2-(2,3-difluorophenyl)ethanol (PubChem CID 65148052) has the molecular formula C14H10BrF3O and a molecular weight of 331.13 g/mol. Its IUPAC name is 1-(3-bromo-4-fluorophenyl)-2-(2,3-difluorophenyl)ethanol.
| Compound Name | 1-(3-bromo-4-fluorophenyl)-2-(2,3-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 65148052 |
| Molecular Formula | C14H10BrF3O |
| Molecular Weight | 331.13 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 1-(3-bromo-4-fluorophenyl)-2-(2,3-difluorophenyl)ethanol |
| SMILES | OC(Cc1cccc(F)c1F)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C14H10BrF3O/c15-10-6-8(4-5-11(10)16)13(19)7-9-2-1-3-12(17)14(9)18/h1-6,13,19H,7H2 |
| InChIKey | OKVCURZHGFCUEP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.13 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |