C17H18BrFO — CID 65148286
1-(5-bromo-2-fluorophenyl)-2-(4-propan-2-ylphenyl)ethanol (PubChem CID 65148286) has the molecular formula C17H18BrFO and a molecular weight of 337.23 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-2-(4-propan-2-ylphenyl)ethanol.
| Compound Name | 1-(5-bromo-2-fluorophenyl)-2-(4-propan-2-ylphenyl)ethanol |
|---|---|
| PubChem CID | 65148286 |
| Molecular Formula | C17H18BrFO |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-2-(4-propan-2-ylphenyl)ethanol |
| SMILES | CC(C)c1ccc(CC(O)c2cc(Br)ccc2F)cc1 |
| InChI | InChI=1S/C17H18BrFO/c1-11(2)13-5-3-12(4-6-13)9-17(20)15-10-14(18)7-8-16(15)19/h3-8,10-11,17,20H,9H2,1-2H3 |
| InChIKey | DVJOAFHDFPAZRW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |