About (E)-5-(diethylamino)-4,4-dimethyl-1-phenylpent-1-en-3-one;hydrobromide
(E)-5-(diethylamino)-4,4-dimethyl-1-phenylpent-1-en-3-one;hydrobromide (PubChem CID 6514850) has the molecular formula C17H26BrNO
and a molecular weight of 340.31 g/mol. Its IUPAC name is (E)-5-(diethylamino)-4,4-dimethyl-1-phenylpent-1-en-3-one;hydrobromide.
Molecular Properties
| Compound Name | (E)-5-(diethylamino)-4,4-dimethyl-1-phenylpent-1-en-3-one;hydrobromide |
| PubChem CID | 6514850 |
| Molecular Formula | C17H26BrNO |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (E)-5-(diethylamino)-4,4-dimethyl-1-phenylpent-1-en-3-one;hydrobromide |
| SMILES | Br.CCN(CC)CC(C)(C)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H25NO.BrH/c1-5-18(6-2)14-17(3,4)16(19)13-12-15-10-8-7-9-11-15;/h7-13H,5-6,14H2,1-4H3;1H/b13-12+; |
| InChIKey | NVTKILPKJSMWTB-UEIGIMKUSA-N |
| XLogP | 4.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-(diethylamino)-4,4-dimethyl-1-phenylpent-1-en-3-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-(diethylamino)-4,4-dimethyl-1-phenylpent-1-en-3-one;hydrobromide?
The IUPAC name of (E)-5-(diethylamino)-4,4-dimethyl-1-phenylpent-1-en-3-one;hydrobromide (CID 6514850) is (E)-5-(diethylamino)-4,4-dimethyl-1-phenylpent-1-en-3-one;hydrobromide.
What is the SMILES notation for (E)-5-(diethylamino)-4,4-dimethyl-1-phenylpent-1-en-3-one;hydrobromide?
The canonical SMILES for (E)-5-(diethylamino)-4,4-dimethyl-1-phenylpent-1-en-3-one;hydrobromide is Br.CCN(CC)CC(C)(C)C(=O)/C=C/c1ccccc1.
What is the InChIKey of (E)-5-(diethylamino)-4,4-dimethyl-1-phenylpent-1-en-3-one;hydrobromide?
The InChIKey is NVTKILPKJSMWTB-UEIGIMKUSA-N. The full InChI is InChI=1S/C17H25NO.BrH/c1-5-18(6-2)14-17(3,4)16(19)13-12-15-10-8-7-9-11-15;/h7-13H,5-6,14H2,1-4H3;1H/b13-12+;.
What are the key properties of (E)-5-(diethylamino)-4,4-dimethyl-1-phenylpent-1-en-3-one;hydrobromide?
(E)-5-(diethylamino)-4,4-dimethyl-1-phenylpent-1-en-3-one;hydrobromide has a molecular weight of 340.31 g/mol, XLogP of 4.21, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-(diethylamino)-4,4-dimethyl-1-phenylpent-1-en-3-one;hydrobromide is sourced from PubChem (CID 6514850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).