C13H22N2O2 — CID 65151428
N-(1-aminopentan-3-yl)-2,4,5-trimethylfuran-3-carboxamide (PubChem CID 65151428) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is N-(1-aminopentan-3-yl)-2,4,5-trimethylfuran-3-carboxamide.
| Compound Name | N-(1-aminopentan-3-yl)-2,4,5-trimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 65151428 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | N-(1-aminopentan-3-yl)-2,4,5-trimethylfuran-3-carboxamide |
| SMILES | CCC(CCN)NC(=O)c1c(C)oc(C)c1C |
| InChI | InChI=1S/C13H22N2O2/c1-5-11(6-7-14)15-13(16)12-8(2)9(3)17-10(12)4/h11H,5-7,14H2,1-4H3,(H,15,16) |
| InChIKey | HMXGSJMQFLFVLX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |