About N'-cyclopentyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide
N'-cyclopentyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide (PubChem CID 651517) has the molecular formula C21H30N4O3
and a molecular weight of 386.50 g/mol. Its IUPAC name is N'-cyclopentyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide.
Molecular Properties
| Compound Name | N'-cyclopentyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide |
| PubChem CID | 651517 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | N'-cyclopentyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide |
| SMILES | O=C(CCC(=O)N(CC(=O)NC1CCCC1)C1CCCC1)Nc1ccccn1 |
| InChI | InChI=1S/C21H30N4O3/c26-19(24-18-11-5-6-14-22-18)12-13-21(28)25(17-9-3-4-10-17)15-20(27)23-16-7-1-2-8-16/h5-6,11,14,16-17H,1-4,7-10,12-13,15H2,(H,23,27)(H,22,24,26) |
| InChIKey | RMWPNBFRXLQGHF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-cyclopentyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopentyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide?
The IUPAC name of N'-cyclopentyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide (CID 651517) is N'-cyclopentyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide.
What is the SMILES notation for N'-cyclopentyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide?
The canonical SMILES for N'-cyclopentyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide is O=C(CCC(=O)N(CC(=O)NC1CCCC1)C1CCCC1)Nc1ccccn1.
What is the InChIKey of N'-cyclopentyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide?
The InChIKey is RMWPNBFRXLQGHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N4O3/c26-19(24-18-11-5-6-14-22-18)12-13-21(28)25(17-9-3-4-10-17)15-20(27)23-16-7-1-2-8-16/h5-6,11,14,16-17H,1-4,7-10,12-13,15H2,(H,23,27)(H,22,24,26).
What are the key properties of N'-cyclopentyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide?
N'-cyclopentyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide has a molecular weight of 386.50 g/mol, XLogP of 2.63, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopentyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide is sourced from PubChem (CID 651517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).