C12H11Cl3OS — CID 65152236
3-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-2,4,5-trimethylfuran (PubChem CID 65152236) has the molecular formula C12H11Cl3OS and a molecular weight of 309.65 g/mol. Its IUPAC name is 3-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-2,4,5-trimethylfuran.
| Compound Name | 3-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-2,4,5-trimethylfuran |
|---|---|
| PubChem CID | 65152236 |
| Molecular Formula | C12H11Cl3OS |
| Molecular Weight | 309.65 g/mol |
| Exact Mass | 307.96 |
| IUPAC Name | 3-[chloro-(2,5-dichlorothiophen-3-yl)methyl]-2,4,5-trimethylfuran |
| SMILES | Cc1oc(C)c(C(Cl)c2cc(Cl)sc2Cl)c1C |
| InChI | InChI=1S/C12H11Cl3OS/c1-5-6(2)16-7(3)10(5)11(14)8-4-9(13)17-12(8)15/h4,11H,1-3H3 |
| InChIKey | LETADBWTHVEQAA-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.65 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|