C17H26N2O — CID 651523
2-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide (PubChem CID 651523) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 2-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide.
| Compound Name | 2-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 651523 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 2-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
| SMILES | Cc1ccccc1C(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C17H26N2O/c1-12-8-6-7-9-14(12)15(20)18-13-10-16(2,3)19-17(4,5)11-13/h6-9,13,19H,10-11H2,1-5H3,(H,18,20) |
| InChIKey | CTOSAFSGMPWCEW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |