About N-(2-aminoethyl)-2,4,5-trimethyloxolane-3-carboxamide
N-(2-aminoethyl)-2,4,5-trimethyloxolane-3-carboxamide (PubChem CID 65152514) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,4,5-trimethyloxolane-3-carboxamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-2,4,5-trimethyloxolane-3-carboxamide |
| PubChem CID | 65152514 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | N-(2-aminoethyl)-2,4,5-trimethyloxolane-3-carboxamide |
| SMILES | CC1OC(C)C(C(=O)NCCN)C1C |
| InChI | InChI=1S/C10H20N2O2/c1-6-7(2)14-8(3)9(6)10(13)12-5-4-11/h6-9H,4-5,11H2,1-3H3,(H,12,13) |
| InChIKey | ZHBPJJUCIOXKCD-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-aminoethyl)-2,4,5-trimethyloxolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-2,4,5-trimethyloxolane-3-carboxamide?
The IUPAC name of N-(2-aminoethyl)-2,4,5-trimethyloxolane-3-carboxamide (CID 65152514) is N-(2-aminoethyl)-2,4,5-trimethyloxolane-3-carboxamide.
What is the SMILES notation for N-(2-aminoethyl)-2,4,5-trimethyloxolane-3-carboxamide?
The canonical SMILES for N-(2-aminoethyl)-2,4,5-trimethyloxolane-3-carboxamide is CC1OC(C)C(C(=O)NCCN)C1C.
What is the InChIKey of N-(2-aminoethyl)-2,4,5-trimethyloxolane-3-carboxamide?
The InChIKey is ZHBPJJUCIOXKCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-6-7(2)14-8(3)9(6)10(13)12-5-4-11/h6-9H,4-5,11H2,1-3H3,(H,12,13).
What are the key properties of N-(2-aminoethyl)-2,4,5-trimethyloxolane-3-carboxamide?
N-(2-aminoethyl)-2,4,5-trimethyloxolane-3-carboxamide has a molecular weight of 200.28 g/mol, XLogP of 0.12, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-2,4,5-trimethyloxolane-3-carboxamide is sourced from PubChem (CID 65152514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).